C31H27N3O4S3 — CID 160777616
azane;6-methyl-2-[2-[4-[3-(4-methylphenyl)-2-oxopropyl]phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid (PubChem CID 160777616) has the molecular formula C31H27N3O4S3 and a molecular weight of 601.78 g/mol. Its IUPAC name is azane;6-methyl-2-[2-[4-[3-(4-methylphenyl)-2-oxopropyl]phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | azane;6-methyl-2-[2-[4-[3-(4-methylphenyl)-2-oxopropyl]phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 160777616 |
| Molecular Formula | C31H27N3O4S3 |
| Molecular Weight | 601.78 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | azane;6-methyl-2-[2-[4-[3-(4-methylphenyl)-2-oxopropyl]phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
| SMILES | Cc1ccc(CC(=O)Cc2ccc(-c3nc4ccc(-c5nc6ccc(C)c(S(=O)(=O)O)c6s5)cc4s3)cc2)cc1.N |
| InChI | InChI=1S/C31H24N2O4S3.H3N/c1-18-3-6-20(7-4-18)15-24(34)16-21-8-10-22(11-9-21)30-32-25-14-12-23(17-27(25)38-30)31-33-26-13-5-19(2)29(28(26)39-31)40(35,36)37;/h3-14,17H,15-16H2,1-2H3,(H,35,36,37);1H3 |
| InChIKey | UWQVNORUFSRNJT-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.78 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|