C33H27F6N3O4S3 — CID 144551827
acetaldehyde;1,3-bis(trifluoromethyl)cyclohepta-1,3,5-triene;6-methyl-2-[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid (PubChem CID 144551827) has the molecular formula C33H27F6N3O4S3 and a molecular weight of 739.78 g/mol. Its IUPAC name is acetaldehyde;1,3-bis(trifluoromethyl)cyclohepta-1,3,5-triene;6-methyl-2-[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid.
| Compound Name | acetaldehyde;1,3-bis(trifluoromethyl)cyclohepta-1,3,5-triene;6-methyl-2-[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
|---|---|
| PubChem CID | 144551827 |
| Molecular Formula | C33H27F6N3O4S3 |
| Molecular Weight | 739.78 g/mol |
| Exact Mass | 739.11 |
| IUPAC Name | acetaldehyde;1,3-bis(trifluoromethyl)cyclohepta-1,3,5-triene;6-methyl-2-[2-[4-(methylamino)phenyl]-1,3-benzothiazol-6-yl]-1,3-benzothiazole-7-sulfonic acid |
| SMILES | CC=O.CNc1ccc(-c2nc3ccc(-c4nc5ccc(C)c(S(=O)(=O)O)c5s4)cc3s2)cc1.FC(F)(F)C1=CC=CCC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C22H17N3O3S3.C9H6F6.C2H4O/c1-12-3-9-17-19(20(12)31(26,27)28)30-22(25-17)14-6-10-16-18(11-14)29-21(24-16)13-4-7-15(23-2)8-5-13;10-8(11,12)6-3-1-2-4-7(5-6)9(13,14)15;1-2-3/h3-11,23H,1-2H3,(H,26,27,28);1-3,5H,4H2;2H,1H3 |
| InChIKey | AFGKLDQYJJPLLV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.78 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|