C16H21N3O5S — CID 173081119
methyl 2-hydrazinylpyridine-3-carboxylate;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 173081119) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 2-hydrazinylpyridine-3-carboxylate;2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | methyl 2-hydrazinylpyridine-3-carboxylate;2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173081119 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | methyl 2-hydrazinylpyridine-3-carboxylate;2,4,6-trimethylbenzenesulfonic acid |
| SMILES | COC(=O)c1cccnc1NN.Cc1cc(C)c(S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C7H9N3O2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-12-7(11)5-3-2-4-9-6(5)10-8/h4-5H,1-3H3,(H,10,11,12);2-4H,8H2,1H3,(H,9,10) |
| InChIKey | IFZWXCHQWYSSQO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|