C11H16N2O3 — CID 65034793
methyl 2-[(3-hydroxy-2-methylpropyl)amino]pyridine-3-carboxylate (PubChem CID 65034793) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 2-[(3-hydroxy-2-methylpropyl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(3-hydroxy-2-methylpropyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 65034793 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | methyl 2-[(3-hydroxy-2-methylpropyl)amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NCC(C)CO |
| InChI | InChI=1S/C11H16N2O3/c1-8(7-14)6-13-10-9(11(15)16-2)4-3-5-12-10/h3-5,8,14H,6-7H2,1-2H3,(H,12,13) |
| InChIKey | FCFNQBVYUJGLLE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |