C11H16N2O4 — CID 107389941
methyl 2-(2,2-dimethoxyethylamino)pyridine-3-carboxylate (PubChem CID 107389941) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 2-(2,2-dimethoxyethylamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-(2,2-dimethoxyethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 107389941 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl 2-(2,2-dimethoxyethylamino)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NCC(OC)OC |
| InChI | InChI=1S/C11H16N2O4/c1-15-9(16-2)7-13-10-8(11(14)17-3)5-4-6-12-10/h4-6,9H,7H2,1-3H3,(H,12,13) |
| InChIKey | JEBSRQZVIPWVBV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|