C11H14N2O2 — CID 114617741
methyl 2-(2-methylprop-2-enylamino)pyridine-3-carboxylate (PubChem CID 114617741) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl 2-(2-methylprop-2-enylamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-(2-methylprop-2-enylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 114617741 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | methyl 2-(2-methylprop-2-enylamino)pyridine-3-carboxylate |
| SMILES | C=C(C)CNc1ncccc1C(=O)OC |
| InChI | InChI=1S/C11H14N2O2/c1-8(2)7-13-10-9(11(14)15-3)5-4-6-12-10/h4-6H,1,7H2,2-3H3,(H,12,13) |
| InChIKey | CKOGBLAILPSJGS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|