C12H19N3O2 — CID 55098006
methyl 2-[2-[ethyl(methyl)amino]ethylamino]pyridine-3-carboxylate (PubChem CID 55098006) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-[2-[ethyl(methyl)amino]ethylamino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[2-[ethyl(methyl)amino]ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55098006 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | methyl 2-[2-[ethyl(methyl)amino]ethylamino]pyridine-3-carboxylate |
| SMILES | CCN(C)CCNc1ncccc1C(=O)OC |
| InChI | InChI=1S/C12H19N3O2/c1-4-15(2)9-8-14-11-10(12(16)17-3)6-5-7-13-11/h5-7H,4,8-9H2,1-3H3,(H,13,14) |
| InChIKey | QUKBLDJAKYXIRX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |