C12H18N2O3 — CID 104695550
methyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate (PubChem CID 104695550) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695550 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | methyl 2-[(2-methoxy-2-methylpropyl)amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NCC(C)(C)OC |
| InChI | InChI=1S/C12H18N2O3/c1-12(2,17-4)8-14-10-9(11(15)16-3)6-5-7-13-10/h5-7H,8H2,1-4H3,(H,13,14) |
| InChIKey | QFVZGPNVJIVQFX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |