C12H19N3O3 — CID 104765047
methyl 3-amino-2-[(2-methoxy-2-methylpropyl)amino]pyridine-4-carboxylate (PubChem CID 104765047) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 3-amino-2-[(2-methoxy-2-methylpropyl)amino]pyridine-4-carboxylate.
| Compound Name | methyl 3-amino-2-[(2-methoxy-2-methylpropyl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 104765047 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | methyl 3-amino-2-[(2-methoxy-2-methylpropyl)amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccnc(NCC(C)(C)OC)c1N |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,18-4)7-15-10-9(13)8(5-6-14-10)11(16)17-3/h5-6H,7,13H2,1-4H3,(H,14,15) |
| InChIKey | MKEFLFVGNADSFW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |