C13H18N2O2 — CID 104695593
methyl 2-[(1-methylcyclobutyl)methylamino]pyridine-3-carboxylate (PubChem CID 104695593) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is methyl 2-[(1-methylcyclobutyl)methylamino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(1-methylcyclobutyl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 104695593 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | methyl 2-[(1-methylcyclobutyl)methylamino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1NCC1(C)CCC1 |
| InChI | InChI=1S/C13H18N2O2/c1-13(6-4-7-13)9-15-11-10(12(16)17-2)5-3-8-14-11/h3,5,8H,4,6-7,9H2,1-2H3,(H,14,15) |
| InChIKey | AVXMMJUUBMNTMS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |