C16H25N3O2 — CID 83112699
ethyl 2-[[1-(dimethylamino)cyclopentyl]methylamino]pyridine-3-carboxylate (PubChem CID 83112699) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethyl 2-[[1-(dimethylamino)cyclopentyl]methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[1-(dimethylamino)cyclopentyl]methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 83112699 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethyl 2-[[1-(dimethylamino)cyclopentyl]methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC1(N(C)C)CCCC1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-21-15(20)13-8-7-11-17-14(13)18-12-16(19(2)3)9-5-6-10-16/h7-8,11H,4-6,9-10,12H2,1-3H3,(H,17,18) |
| InChIKey | WGOFTYLIRHQHQS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |