C16H25N3O3 — CID 133471175
ethyl 2-[[4-(dimethylamino)oxan-4-yl]methylamino]pyridine-3-carboxylate (PubChem CID 133471175) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is ethyl 2-[[4-(dimethylamino)oxan-4-yl]methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[4-(dimethylamino)oxan-4-yl]methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133471175 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | ethyl 2-[[4-(dimethylamino)oxan-4-yl]methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1NCC1(N(C)C)CCOCC1 |
| InChI | InChI=1S/C16H25N3O3/c1-4-22-15(20)13-6-5-9-17-14(13)18-12-16(19(2)3)7-10-21-11-8-16/h5-6,9H,4,7-8,10-12H2,1-3H3,(H,17,18) |
| InChIKey | IHTFUTYHUJSVLQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |