C11H16N2O3 — CID 60722314
methyl 2-(1-methoxypropan-2-ylamino)pyridine-3-carboxylate (PubChem CID 60722314) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 2-(1-methoxypropan-2-ylamino)pyridine-3-carboxylate.
| Compound Name | methyl 2-(1-methoxypropan-2-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 60722314 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | methyl 2-(1-methoxypropan-2-ylamino)pyridine-3-carboxylate |
| SMILES | COCC(C)Nc1ncccc1C(=O)OC |
| InChI | InChI=1S/C11H16N2O3/c1-8(7-15-2)13-10-9(11(14)16-3)5-4-6-12-10/h4-6,8H,7H2,1-3H3,(H,12,13) |
| InChIKey | SKVDSKTUMLYHOF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |