C13H19NO4 — CID 63697063
methyl 3-(2,2-dimethoxyethylamino)-2-methylbenzoate (PubChem CID 63697063) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 3-(2,2-dimethoxyethylamino)-2-methylbenzoate.
| Compound Name | methyl 3-(2,2-dimethoxyethylamino)-2-methylbenzoate |
|---|---|
| PubChem CID | 63697063 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl 3-(2,2-dimethoxyethylamino)-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NCC(OC)OC)c1C |
| InChI | InChI=1S/C13H19NO4/c1-9-10(13(15)18-4)6-5-7-11(9)14-8-12(16-2)17-3/h5-7,12,14H,8H2,1-4H3 |
| InChIKey | GYKVHGRLZWRJCZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|