C11H15N3O3 — CID 81065361
4-[(3-carbamoyl-2-pyridinyl)amino]-3-methylbutanoic acid (PubChem CID 81065361) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-[(3-carbamoyl-2-pyridinyl)amino]-3-methylbutanoic acid.
| Compound Name | 4-[(3-carbamoyl-2-pyridinyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81065361 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-[(3-carbamoyl-2-pyridinyl)amino]-3-methylbutanoic acid |
| SMILES | CC(CNc1ncccc1C(N)=O)CC(=O)O |
| InChI | InChI=1S/C11H15N3O3/c1-7(5-9(15)16)6-14-11-8(10(12)17)3-2-4-13-11/h2-4,7H,5-6H2,1H3,(H2,12,17)(H,13,14)(H,15,16) |
| InChIKey | IEVVUXPPECBXKF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |