C13H21N3S — CID 83144500
2-(2,3,3-trimethylbutylamino)pyridine-3-carbothioamide (PubChem CID 83144500) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-(2,3,3-trimethylbutylamino)pyridine-3-carbothioamide.
| Compound Name | 2-(2,3,3-trimethylbutylamino)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 83144500 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-(2,3,3-trimethylbutylamino)pyridine-3-carbothioamide |
| SMILES | CC(CNc1ncccc1C(N)=S)C(C)(C)C |
| InChI | InChI=1S/C13H21N3S/c1-9(13(2,3)4)8-16-12-10(11(14)17)6-5-7-15-12/h5-7,9H,8H2,1-4H3,(H2,14,17)(H,15,16) |
| InChIKey | MKYMPIHYGLVGPN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|