C19H20BrN4O3S+ — CID 170062295
2-[[(1-amino-5-bromo-3-phenylpyrazin-1-ium-2-yl)amino]methyl]-4,6-dimethylbenzenesulfonic acid (PubChem CID 170062295) has the molecular formula C19H20BrN4O3S+ and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-[[(1-amino-5-bromo-3-phenylpyrazin-1-ium-2-yl)amino]methyl]-4,6-dimethylbenzenesulfonic acid.
| Compound Name | 2-[[(1-amino-5-bromo-3-phenylpyrazin-1-ium-2-yl)amino]methyl]-4,6-dimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 170062295 |
| Molecular Formula | C19H20BrN4O3S+ |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-[[(1-amino-5-bromo-3-phenylpyrazin-1-ium-2-yl)amino]methyl]-4,6-dimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)O)c(CNc2c(-c3ccccc3)nc(Br)c[n+]2N)c1 |
| InChI | InChI=1S/C19H19BrN4O3S/c1-12-8-13(2)18(28(25,26)27)15(9-12)10-22-19-17(14-6-4-3-5-7-14)23-16(20)11-24(19)21/h3-9,11H,10,21H2,1-2H3,(H,25,26,27)/p+1 |
| InChIKey | LBZKXNXPLDXOBG-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|