C21H30N2O3S — CID 138965583
2-[[[(2S)-3-methyl-1-(2,4,6-trimethylanilino)butan-2-yl]amino]methyl]benzenesulfonic acid (PubChem CID 138965583) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-[[[(2S)-3-methyl-1-(2,4,6-trimethylanilino)butan-2-yl]amino]methyl]benzenesulfonic acid.
| Compound Name | 2-[[[(2S)-3-methyl-1-(2,4,6-trimethylanilino)butan-2-yl]amino]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 138965583 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-[[[(2S)-3-methyl-1-(2,4,6-trimethylanilino)butan-2-yl]amino]methyl]benzenesulfonic acid |
| SMILES | Cc1cc(C)c(NC[C@@H](NCc2ccccc2S(=O)(=O)O)C(C)C)c(C)c1 |
| InChI | InChI=1S/C21H30N2O3S/c1-14(2)19(13-23-21-16(4)10-15(3)11-17(21)5)22-12-18-8-6-7-9-20(18)27(24,25)26/h6-11,14,19,22-23H,12-13H2,1-5H3,(H,24,25,26)/t19-/m1/s1 |
| InChIKey | IBYMRPAUQVANGP-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|