C17H23NO3S — CID 173322724
methanesulfonic acid;1-(2-methylphenyl)-N-[(2-methylphenyl)methyl]methanamine (PubChem CID 173322724) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is methanesulfonic acid;1-(2-methylphenyl)-N-[(2-methylphenyl)methyl]methanamine.
| Compound Name | methanesulfonic acid;1-(2-methylphenyl)-N-[(2-methylphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 173322724 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | methanesulfonic acid;1-(2-methylphenyl)-N-[(2-methylphenyl)methyl]methanamine |
| SMILES | CS(=O)(=O)O.Cc1ccccc1CNCc1ccccc1C |
| InChI | InChI=1S/C16H19N.CH4O3S/c1-13-7-3-5-9-15(13)11-17-12-16-10-6-4-8-14(16)2;1-5(2,3)4/h3-10,17H,11-12H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | WYCDADUBXRBRNB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|