C39H42N2O3S — CID 126765567
2-[bis[2-methyl-4-(2,4,6-trimethylanilino)phenyl]methyl]benzenesulfonic acid (PubChem CID 126765567) has the molecular formula C39H42N2O3S and a molecular weight of 618.84 g/mol. Its IUPAC name is 2-[bis[2-methyl-4-(2,4,6-trimethylanilino)phenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[bis[2-methyl-4-(2,4,6-trimethylanilino)phenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 126765567 |
| Molecular Formula | C39H42N2O3S |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | 2-[bis[2-methyl-4-(2,4,6-trimethylanilino)phenyl]methyl]benzenesulfonic acid |
| SMILES | Cc1cc(C)c(Nc2ccc(C(c3ccc(Nc4c(C)cc(C)cc4C)cc3C)c3ccccc3S(=O)(=O)O)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C39H42N2O3S/c1-23-17-27(5)38(28(6)18-23)40-31-13-15-33(25(3)21-31)37(35-11-9-10-12-36(35)45(42,43)44)34-16-14-32(22-26(34)4)41-39-29(7)19-24(2)20-30(39)8/h9-22,37,40-41H,1-8H3,(H,42,43,44) |
| InChIKey | OVKVJDPSIXYRGD-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|