C39H42N2O8S2 — CID 135250908
4-[bis[2-methoxy-4-(2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid (PubChem CID 135250908) has the molecular formula C39H42N2O8S2 and a molecular weight of 730.90 g/mol. Its IUPAC name is 4-[bis[2-methoxy-4-(2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[bis[2-methoxy-4-(2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 135250908 |
| Molecular Formula | C39H42N2O8S2 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.24 |
| IUPAC Name | 4-[bis[2-methoxy-4-(2,4,6-trimethylanilino)phenyl]methyl]benzene-1,3-disulfonic acid |
| SMILES | COc1cc(Nc2c(C)cc(C)cc2C)ccc1C(c1ccc(Nc2c(C)cc(C)cc2C)cc1OC)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C39H42N2O8S2/c1-22-15-24(3)38(25(4)16-22)40-28-9-12-31(34(19-28)48-7)37(33-14-11-30(50(42,43)44)21-36(33)51(45,46)47)32-13-10-29(20-35(32)49-8)41-39-26(5)17-23(2)18-27(39)6/h9-21,37,40-41H,1-8H3,(H,42,43,44)(H,45,46,47) |
| InChIKey | CHGVPBNZCCHMRV-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|