C40H42N2O9S2 — CID 135253964
5-[(2,4-disulfophenyl)-[4-(3-methoxy-2,4,6-trimethylanilino)phenyl]methyl]-2-(2,3,4,6-tetramethylanilino)benzoic acid (PubChem CID 135253964) has the molecular formula C40H42N2O9S2 and a molecular weight of 758.91 g/mol. Its IUPAC name is 5-[(2,4-disulfophenyl)-[4-(3-methoxy-2,4,6-trimethylanilino)phenyl]methyl]-2-(2,3,4,6-tetramethylanilino)benzoic acid.
| Compound Name | 5-[(2,4-disulfophenyl)-[4-(3-methoxy-2,4,6-trimethylanilino)phenyl]methyl]-2-(2,3,4,6-tetramethylanilino)benzoic acid |
|---|---|
| PubChem CID | 135253964 |
| Molecular Formula | C40H42N2O9S2 |
| Molecular Weight | 758.91 g/mol |
| Exact Mass | 758.23 |
| IUPAC Name | 5-[(2,4-disulfophenyl)-[4-(3-methoxy-2,4,6-trimethylanilino)phenyl]methyl]-2-(2,3,4,6-tetramethylanilino)benzoic acid |
| SMILES | COc1c(C)cc(C)c(Nc2ccc(C(c3ccc(Nc4c(C)cc(C)c(C)c4C)c(C(=O)O)c3)c3ccc(S(=O)(=O)O)cc3S(=O)(=O)O)cc2)c1C |
| InChI | InChI=1S/C40H42N2O9S2/c1-21-17-22(2)37(26(6)25(21)5)42-34-16-11-29(19-33(34)40(43)44)36(32-15-14-31(52(45,46)47)20-35(32)53(48,49)50)28-9-12-30(13-10-28)41-38-23(3)18-24(4)39(51-8)27(38)7/h9-20,36,41-42H,1-8H3,(H,43,44)(H,45,46,47)(H,48,49,50) |
| InChIKey | WVQAVNYIRFRIMJ-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.91 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|