C35H31N2O7S2+ — CID 58942415
4-[2,7-bis(2,6-dimethylanilino)xanthen-10-ium-9-yl]benzene-1,3-disulfonic acid (PubChem CID 58942415) has the molecular formula C35H31N2O7S2+ and a molecular weight of 655.77 g/mol. Its IUPAC name is 4-[2,7-bis(2,6-dimethylanilino)xanthen-10-ium-9-yl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[2,7-bis(2,6-dimethylanilino)xanthen-10-ium-9-yl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 58942415 |
| Molecular Formula | C35H31N2O7S2+ |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | 4-[2,7-bis(2,6-dimethylanilino)xanthen-10-ium-9-yl]benzene-1,3-disulfonic acid |
| SMILES | Cc1cccc(C)c1Nc1ccc2[o+]c3ccc(Nc4c(C)cccc4C)cc3c(-c3ccc(S(=O)(=O)O)cc3S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C35H30N2O7S2/c1-20-7-5-8-21(2)34(20)36-24-11-15-30-28(17-24)33(27-14-13-26(45(38,39)40)19-32(27)46(41,42)43)29-18-25(12-16-31(29)44-30)37-35-22(3)9-6-10-23(35)4/h5-19,36-37H,1-4H3,(H-,38,39,40,41,42,43)/p+1 |
| InChIKey | XYDUEBBOUHWLJT-UHFFFAOYSA-O |
| XLogP | 8.75 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|