C57H74N6O8S2 — CID 129025645
4-[bis[4-[2,4,6-trimethyl-3-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]anilino]phenyl]methyl]benzene-1,3-disulfonic acid (PubChem CID 129025645) has the molecular formula C57H74N6O8S2 and a molecular weight of 1035.39 g/mol. Its IUPAC name is 4-[bis[4-[2,4,6-trimethyl-3-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]anilino]phenyl]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[bis[4-[2,4,6-trimethyl-3-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]anilino]phenyl]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 129025645 |
| Molecular Formula | C57H74N6O8S2 |
| Molecular Weight | 1035.39 g/mol |
| Exact Mass | 1034.50 |
| IUPAC Name | 4-[bis[4-[2,4,6-trimethyl-3-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]anilino]phenyl]methyl]benzene-1,3-disulfonic acid |
| SMILES | Cc1cc(C)c(Nc2ccc(C(c3ccc(Nc4c(C)cc(C)c(NC(=O)C5CC(C)(C)NC(C)(C)C5)c4C)cc3)c3ccc(S(=O)(=O)O)cc3S(=O)(=O)O)cc2)c(C)c1NC(=O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C57H74N6O8S2/c1-32-25-34(3)50(60-52(64)40-28-54(7,8)62-55(9,10)29-40)36(5)48(32)58-42-19-15-38(16-20-42)47(45-24-23-44(72(66,67)68)27-46(45)73(69,70)71)39-17-21-43(22-18-39)59-49-33(2)26-35(4)51(37(49)6)61-53(65)41-30-56(11,12)63-57(13,14)31-41/h15-27,40-41,47,58-59,62-63H,28-31H2,1-14H3,(H,60,64)(H,61,65)(H,66,67,68)(H,69,70,71) |
| InChIKey | HPJZVXVKZORALW-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 215.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.39 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|