C18H25ClN2O2 — CID 86574555
N-(4-chloro-3-methylphenyl)-2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 86574555) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is N-(4-chloro-3-methylphenyl)-2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | N-(4-chloro-3-methylphenyl)-2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 86574555 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-(4-chloro-3-methylphenyl)-2-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)C2CC(C)(C)NC(C)(C)C2)ccc1Cl |
| InChI | InChI=1S/C18H25ClN2O2/c1-11-8-13(6-7-14(11)19)20-16(23)15(22)12-9-17(2,3)21-18(4,5)10-12/h6-8,12,21H,9-10H2,1-5H3,(H,20,23) |
| InChIKey | JOCWOILXWOTJER-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|