C20H30ClN3O3 — CID 53326853
N'-(4-chloro-3-propan-2-yloxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 53326853) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is N'-(4-chloro-3-propan-2-yloxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(4-chloro-3-propan-2-yloxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 53326853 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N'-(4-chloro-3-propan-2-yloxyphenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC(C)Oc1cc(NC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)ccc1Cl |
| InChI | InChI=1S/C20H30ClN3O3/c1-12(2)27-16-9-13(7-8-15(16)21)22-17(25)18(26)23-14-10-19(3,4)24-20(5,6)11-14/h7-9,12,14,24H,10-11H2,1-6H3,(H,22,25)(H,23,26) |
| InChIKey | VVLQAOMQALPNET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|