C46H56N4O3S — CID 126765508
2-[bis[4-[benzyl(ethyl)amino]phenyl]methyl]-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzenesulfonic acid (PubChem CID 126765508) has the molecular formula C46H56N4O3S and a molecular weight of 745.05 g/mol. Its IUPAC name is 2-[bis[4-[benzyl(ethyl)amino]phenyl]methyl]-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzenesulfonic acid.
| Compound Name | 2-[bis[4-[benzyl(ethyl)amino]phenyl]methyl]-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 126765508 |
| Molecular Formula | C46H56N4O3S |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 744.41 |
| IUPAC Name | 2-[bis[4-[benzyl(ethyl)amino]phenyl]methyl]-5-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]benzenesulfonic acid |
| SMILES | CCN(Cc1ccccc1)c1ccc(C(c2ccc(N(CC)Cc3ccccc3)cc2)c2ccc(NC3CC(C)(C)NC(C)(C)C3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C46H56N4O3S/c1-7-49(32-34-15-11-9-12-16-34)40-24-19-36(20-25-40)44(37-21-26-41(27-22-37)50(8-2)33-35-17-13-10-14-18-35)42-28-23-38(29-43(42)54(51,52)53)47-39-30-45(3,4)48-46(5,6)31-39/h9-29,39,44,47-48H,7-8,30-33H2,1-6H3,(H,51,52,53) |
| InChIKey | YNUDUCXZCMDURQ-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|