C23H29N3O — CID 119458968
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[benzyl(ethyl)amino]benzamide (PubChem CID 119458968) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[benzyl(ethyl)amino]benzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[benzyl(ethyl)amino]benzamide |
|---|---|
| PubChem CID | 119458968 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[benzyl(ethyl)amino]benzamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(C(=O)NC2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C23H29N3O/c1-2-26(16-17-6-4-3-5-7-17)22-12-8-18(9-13-22)23(27)25-21-14-19-10-11-20(15-21)24-19/h3-9,12-13,19-21,24H,2,10-11,14-16H2,1H3,(H,25,27) |
| InChIKey | LCNMDPHZLLOMKH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |