C18H27N3O — CID 119459719
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[methyl(propyl)amino]benzamide (PubChem CID 119459719) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[methyl(propyl)amino]benzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[methyl(propyl)amino]benzamide |
|---|---|
| PubChem CID | 119459719 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-[methyl(propyl)amino]benzamide |
| SMILES | CCCN(C)c1ccc(C(=O)NC2CC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C18H27N3O/c1-3-10-21(2)17-8-4-13(5-9-17)18(22)20-16-11-14-6-7-15(12-16)19-14/h4-5,8-9,14-16,19H,3,6-7,10-12H2,1-2H3,(H,20,22) |
| InChIKey | DDLGEJYAASRXLQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |