C35H32N4O12S2 — CID 135250892
4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonic acid (PubChem CID 135250892) has the molecular formula C35H32N4O12S2 and a molecular weight of 764.79 g/mol. Its IUPAC name is 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 135250892 |
| Molecular Formula | C35H32N4O12S2 |
| Molecular Weight | 764.79 g/mol |
| Exact Mass | 764.15 |
| IUPAC Name | 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonic acid |
| SMILES | COc1cc(NCc2ccc([N+](=O)[O-])cc2)ccc1C(c1ccc(NCc2ccc([N+](=O)[O-])cc2)cc1OC)c1ccc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C35H32N4O12S2/c1-50-32-17-24(36-20-22-3-9-26(10-4-22)38(40)41)7-14-29(32)35(31-16-13-28(52(44,45)46)19-34(31)53(47,48)49)30-15-8-25(18-33(30)51-2)37-21-23-5-11-27(12-6-23)39(42)43/h3-19,35-37H,20-21H2,1-2H3,(H,44,45,46)(H,47,48,49) |
| InChIKey | ZMDBOZKICUSTER-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 237.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|