C35H30N4NaO12S2- — CID 140890117
sodium 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonate (PubChem CID 140890117) has the molecular formula C35H30N4NaO12S2- and a molecular weight of 785.76 g/mol. Its IUPAC name is sodium 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonate.
| Compound Name | sodium 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 140890117 |
| Molecular Formula | C35H30N4NaO12S2- |
| Molecular Weight | 785.76 g/mol |
| Exact Mass | 785.12 |
| IUPAC Name | sodium 4-[bis[2-methoxy-4-[(4-nitrophenyl)methylamino]phenyl]methyl]benzene-1,3-disulfonate |
| SMILES | COc1cc(NCc2ccc([N+](=O)[O-])cc2)ccc1C(c1ccc(NCc2ccc([N+](=O)[O-])cc2)cc1OC)c1ccc(S(=O)(=O)[O-])cc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C35H32N4O12S2.Na/c1-50-32-17-24(36-20-22-3-9-26(10-4-22)38(40)41)7-14-29(32)35(31-16-13-28(52(44,45)46)19-34(31)53(47,48)49)30-15-8-25(18-33(30)51-2)37-21-23-5-11-27(12-6-23)39(42)43;/h3-19,35-37H,20-21H2,1-2H3,(H,44,45,46)(H,47,48,49);/q;+1/p-2 |
| InChIKey | BXVHVCMGCDEPHZ-UHFFFAOYSA-L |
| XLogP | 2.74 |
| TPSA | 243.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|