C37H36O3S — CID 159114903
2-[bis[4-[(2,6-dimethylphenyl)methyl]phenyl]methyl]benzenesulfonic acid (PubChem CID 159114903) has the molecular formula C37H36O3S and a molecular weight of 560.76 g/mol. Its IUPAC name is 2-[bis[4-[(2,6-dimethylphenyl)methyl]phenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[bis[4-[(2,6-dimethylphenyl)methyl]phenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 159114903 |
| Molecular Formula | C37H36O3S |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | 2-[bis[4-[(2,6-dimethylphenyl)methyl]phenyl]methyl]benzenesulfonic acid |
| SMILES | Cc1cccc(C)c1Cc1ccc(C(c2ccc(Cc3c(C)cccc3C)cc2)c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C37H36O3S/c1-25-9-7-10-26(2)34(25)23-29-15-19-31(20-16-29)37(33-13-5-6-14-36(33)41(38,39)40)32-21-17-30(18-22-32)24-35-27(3)11-8-12-28(35)4/h5-22,37H,23-24H2,1-4H3,(H,38,39,40) |
| InChIKey | FLNXXUFKOSUJTC-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|