C39H44N4O9S3 — CID 129024909
3-amino-5-[4-[[4-(3-amino-N,2,4,6-tetramethyl-5-sulfoanilino)phenyl]-(2-sulfophenyl)methyl]-N-methylanilino]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 129024909) has the molecular formula C39H44N4O9S3 and a molecular weight of 809.00 g/mol. Its IUPAC name is 3-amino-5-[4-[[4-(3-amino-N,2,4,6-tetramethyl-5-sulfoanilino)phenyl]-(2-sulfophenyl)methyl]-N-methylanilino]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-amino-5-[4-[[4-(3-amino-N,2,4,6-tetramethyl-5-sulfoanilino)phenyl]-(2-sulfophenyl)methyl]-N-methylanilino]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 129024909 |
| Molecular Formula | C39H44N4O9S3 |
| Molecular Weight | 809.00 g/mol |
| Exact Mass | 808.23 |
| IUPAC Name | 3-amino-5-[4-[[4-(3-amino-N,2,4,6-tetramethyl-5-sulfoanilino)phenyl]-(2-sulfophenyl)methyl]-N-methylanilino]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1c(N)c(C)c(S(=O)(=O)O)c(C)c1N(C)c1ccc(C(c2ccc(N(C)c3c(C)c(N)c(C)c(S(=O)(=O)O)c3C)cc2)c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C39H44N4O9S3/c1-21-34(40)23(3)38(54(47,48)49)25(5)36(21)42(7)29-17-13-27(14-18-29)33(31-11-9-10-12-32(31)53(44,45)46)28-15-19-30(20-16-28)43(8)37-22(2)35(41)24(4)39(26(37)6)55(50,51)52/h9-20,33H,40-41H2,1-8H3,(H,44,45,46)(H,47,48,49)(H,50,51,52) |
| InChIKey | BAURSRDLWFCURC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 221.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.00 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|