C32H31NO6S — CID 157278366
2-[(3E)-3-(3,4-dihydroxybutylidene)-6-(2,4,6-trimethylanilino)xanthen-9-yl]benzenesulfonic acid (PubChem CID 157278366) has the molecular formula C32H31NO6S and a molecular weight of 557.67 g/mol. Its IUPAC name is 2-[(3E)-3-(3,4-dihydroxybutylidene)-6-(2,4,6-trimethylanilino)xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[(3E)-3-(3,4-dihydroxybutylidene)-6-(2,4,6-trimethylanilino)xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 157278366 |
| Molecular Formula | C32H31NO6S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | 2-[(3E)-3-(3,4-dihydroxybutylidene)-6-(2,4,6-trimethylanilino)xanthen-9-yl]benzenesulfonic acid |
| SMILES | Cc1cc(C)c(Nc2ccc3c(c2)Oc2c/c(=C/CC(O)CO)ccc2=C3c2ccccc2S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C32H31NO6S/c1-19-14-20(2)32(21(3)15-19)33-23-10-13-26-29(17-23)39-28-16-22(8-11-24(35)18-34)9-12-25(28)31(26)27-6-4-5-7-30(27)40(36,37)38/h4-10,12-17,24,33-35H,11,18H2,1-3H3,(H,36,37,38)/b22-8+ |
| InChIKey | ZKWAUTZOCBUHGR-GZIVZEMBSA-N |
| XLogP | 4.48 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|