C37H30NaO7S2- — CID 148947296
sodium 4-[(E)-[6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfonatophenyl)xanthen-3-ylidene]methyl]-3,5-dimethylbenzenesulfonate (PubChem CID 148947296) has the molecular formula C37H30NaO7S2- and a molecular weight of 673.76 g/mol. Its IUPAC name is sodium 4-[(E)-[6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfonatophenyl)xanthen-3-ylidene]methyl]-3,5-dimethylbenzenesulfonate.
| Compound Name | sodium 4-[(E)-[6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfonatophenyl)xanthen-3-ylidene]methyl]-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 148947296 |
| Molecular Formula | C37H30NaO7S2- |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | sodium 4-[(E)-[6-[(2,6-dimethylphenyl)methyl]-9-(2-sulfonatophenyl)xanthen-3-ylidene]methyl]-3,5-dimethylbenzenesulfonate |
| SMILES | Cc1cc(S(=O)(=O)[O-])cc(C)c1/C=c1\ccc2c(c1)Oc1cc(Cc3c(C)cccc3C)ccc1C=2c1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C37H32O7S2.Na/c1-22-8-7-9-23(2)32(22)18-26-12-14-29-34(20-26)44-35-21-27(19-33-24(3)16-28(17-25(33)4)45(38,39)40)13-15-30(35)37(29)31-10-5-6-11-36(31)46(41,42)43;/h5-17,19-21H,18H2,1-4H3,(H,38,39,40)(H,41,42,43);/q;+1/p-2/b27-19+; |
| InChIKey | PPEMNADGSVGBOS-MHJOWNCHSA-L |
| XLogP | 2.51 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|