C39H38N2O7S2 — CID 159590988
3-amino-5-[(E)-[6-[(3-amino-2,4,6-trimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]methyl]-2,4,6-trimethylbenzenesulfonic acid (PubChem CID 159590988) has the molecular formula C39H38N2O7S2 and a molecular weight of 710.87 g/mol. Its IUPAC name is 3-amino-5-[(E)-[6-[(3-amino-2,4,6-trimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]methyl]-2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 3-amino-5-[(E)-[6-[(3-amino-2,4,6-trimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]methyl]-2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 159590988 |
| Molecular Formula | C39H38N2O7S2 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.21 |
| IUPAC Name | 3-amino-5-[(E)-[6-[(3-amino-2,4,6-trimethylphenyl)methyl]-9-(2-sulfophenyl)xanthen-3-ylidene]methyl]-2,4,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(Cc2ccc3c(c2)Oc2c/c(=C/c4c(C)c(N)c(C)c(S(=O)(=O)O)c4C)ccc2=C3c2ccccc2S(=O)(=O)O)c(C)c1N |
| InChI | InChI=1S/C39H38N2O7S2/c1-20-15-21(2)37(40)22(3)31(20)16-26-11-13-28-33(18-26)48-34-19-27(17-32-23(4)38(41)25(6)39(24(32)5)50(45,46)47)12-14-29(34)36(28)30-9-7-8-10-35(30)49(42,43)44/h7-15,17-19H,16,40-41H2,1-6H3,(H,42,43,44)(H,45,46,47)/b27-17+ |
| InChIKey | LOJKPLOLXTXSSY-WPWMEQJKSA-N |
| XLogP | 5.97 |
| TPSA | 170.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|