C30H29NO4S — CID 90273925
2-[6-(2,6-diethylanilino)-3-methyl-3H-xanthen-9-yl]benzenesulfonic acid (PubChem CID 90273925) has the molecular formula C30H29NO4S and a molecular weight of 499.63 g/mol. Its IUPAC name is 2-[6-(2,6-diethylanilino)-3-methyl-3H-xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[6-(2,6-diethylanilino)-3-methyl-3H-xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90273925 |
| Molecular Formula | C30H29NO4S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 2-[6-(2,6-diethylanilino)-3-methyl-3H-xanthen-9-yl]benzenesulfonic acid |
| SMILES | CCc1cccc(CC)c1Nc1ccc2c(c1)OC1=CC(C)C=CC1=C2c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C30H29NO4S/c1-4-20-9-8-10-21(5-2)30(20)31-22-14-16-24-27(18-22)35-26-17-19(3)13-15-23(26)29(24)25-11-6-7-12-28(25)36(32,33)34/h6-19,31H,4-5H2,1-3H3,(H,32,33,34) |
| InChIKey | CZGSUJJVABWVTR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|