C15H20Br2N2O3S — CID 175757592
2,4-dibromo-3-methyl-2H-pyridin-1-amine;2,4,6-trimethylbenzenesulfonic acid (PubChem CID 175757592) has the molecular formula C15H20Br2N2O3S and a molecular weight of 468.21 g/mol. Its IUPAC name is 2,4-dibromo-3-methyl-2H-pyridin-1-amine;2,4,6-trimethylbenzenesulfonic acid.
| Compound Name | 2,4-dibromo-3-methyl-2H-pyridin-1-amine;2,4,6-trimethylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175757592 |
| Molecular Formula | C15H20Br2N2O3S |
| Molecular Weight | 468.21 g/mol |
| Exact Mass | 465.96 |
| IUPAC Name | 2,4-dibromo-3-methyl-2H-pyridin-1-amine;2,4,6-trimethylbenzenesulfonic acid |
| SMILES | CC1=C(Br)C=CN(N)C1Br.Cc1cc(C)c(S(=O)(=O)O)c(C)c1 |
| InChI | InChI=1S/C9H12O3S.C6H8Br2N2/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;1-4-5(7)2-3-10(9)6(4)8/h4-5H,1-3H3,(H,10,11,12);2-3,6H,9H2,1H3 |
| InChIKey | BRMUCKHYNWOIDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|