C13H16N2O2S — CID 976679
3-methyl-1-(2,4,6-trimethylphenyl)sulfonylpyrazole (PubChem CID 976679) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-methyl-1-(2,4,6-trimethylphenyl)sulfonylpyrazole.
| Compound Name | 3-methyl-1-(2,4,6-trimethylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 976679 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-methyl-1-(2,4,6-trimethylphenyl)sulfonylpyrazole |
| SMILES | Cc1cc(C)c(S(=O)(=O)n2ccc(C)n2)c(C)c1 |
| InChI | InChI=1S/C13H16N2O2S/c1-9-7-10(2)13(11(3)8-9)18(16,17)15-6-5-12(4)14-15/h5-8H,1-4H3 |
| InChIKey | ZSYUJWMRZVZQIB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |