C13H17N3O3S — CID 12633442
pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate (PubChem CID 12633442) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate.
| Compound Name | pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 12633442 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | pyridazin-1-ium-1-amine;2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)[O-])c(C)c1.N[n+]1ccccn1 |
| InChI | InChI=1S/C9H12O3S.C4H6N3/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;5-7-4-2-1-3-6-7/h4-5H,1-3H3,(H,10,11,12);1-4H,(H2,5,6)/q;+1/p-1 |
| InChIKey | QMJRRGHNNTWMRD-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|