C15H18N4O3S — CID 6399315
2,4,6-trimethyl-N-[(E)-1-(1-oxidopyridazin-1-ium-3-yl)ethylideneamino]benzenesulfonamide (PubChem CID 6399315) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[(E)-1-(1-oxidopyridazin-1-ium-3-yl)ethylideneamino]benzenesulfonamide.
| Compound Name | 2,4,6-trimethyl-N-[(E)-1-(1-oxidopyridazin-1-ium-3-yl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 6399315 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2,4,6-trimethyl-N-[(E)-1-(1-oxidopyridazin-1-ium-3-yl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N\NS(=O)(=O)c1c(C)cc(C)cc1C)c1ccc[n+]([O-])n1 |
| InChI | InChI=1S/C15H18N4O3S/c1-10-8-11(2)15(12(3)9-10)23(21,22)18-16-13(4)14-6-5-7-19(20)17-14/h5-9,18H,1-4H3/b16-13+ |
| InChIKey | AUWDZKJNJNBFAD-DTQAZKPQSA-N |
| XLogP | 1.34 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|