About pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide
pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide (PubChem CID 4743591) has the molecular formula C14H15N2O2S-
and a molecular weight of 275.35 g/mol. Its IUPAC name is pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide.
Molecular Properties
| Compound Name | pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
| PubChem CID | 4743591 |
| Molecular Formula | C14H15N2O2S- |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
| SMILES | Cc1cc(C)c(S(=O)(=O)[N-]c2ccncc2)c(C)c1 |
| InChI | InChI=1S/C14H15N2O2S/c1-10-8-11(2)14(12(3)9-10)19(17,18)16-13-4-6-15-7-5-13/h4-9H,1-3H3/q-1 |
| InChIKey | JTWKFWAZRGICTO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide?
The IUPAC name of pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide (CID 4743591) is pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide.
What is the SMILES notation for pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide?
The canonical SMILES for pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide is Cc1cc(C)c(S(=O)(=O)[N-]c2ccncc2)c(C)c1.
What is the InChIKey of pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide?
The InChIKey is JTWKFWAZRGICTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N2O2S/c1-10-8-11(2)14(12(3)9-10)19(17,18)16-13-4-6-15-7-5-13/h4-9H,1-3H3/q-1.
What are the key properties of pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide?
pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide has a molecular weight of 275.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide is sourced from PubChem (CID 4743591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).