C14H15N2O2S- — CID 4743591
pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide (PubChem CID 4743591) has the molecular formula C14H15N2O2S- and a molecular weight of 275.35 g/mol. Its IUPAC name is pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide.
| Compound Name | pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 4743591 |
| Molecular Formula | C14H15N2O2S- |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | pyridin-4-yl-(2,4,6-trimethylphenyl)sulfonylazanide |
| SMILES | Cc1cc(C)c(S(=O)(=O)[N-]c2ccncc2)c(C)c1 |
| InChI | InChI=1S/C14H15N2O2S/c1-10-8-11(2)14(12(3)9-10)19(17,18)16-13-4-6-15-7-5-13/h4-9H,1-3H3/q-1 |
| InChIKey | JTWKFWAZRGICTO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |