C14H14N2O9S3 — CID 174778762
2,3-bis(aminooxysulfonyl)-4-(2-phenylethenyl)benzenesulfonic acid (PubChem CID 174778762) has the molecular formula C14H14N2O9S3 and a molecular weight of 450.47 g/mol. Its IUPAC name is 2,3-bis(aminooxysulfonyl)-4-(2-phenylethenyl)benzenesulfonic acid.
| Compound Name | 2,3-bis(aminooxysulfonyl)-4-(2-phenylethenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 174778762 |
| Molecular Formula | C14H14N2O9S3 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 2,3-bis(aminooxysulfonyl)-4-(2-phenylethenyl)benzenesulfonic acid |
| SMILES | NOS(=O)(=O)c1c(C=Cc2ccccc2)ccc(S(=O)(=O)O)c1S(=O)(=O)ON |
| InChI | InChI=1S/C14H14N2O9S3/c15-24-27(20,21)13-11(7-6-10-4-2-1-3-5-10)8-9-12(26(17,18)19)14(13)28(22,23)25-16/h1-9H,15-16H2,(H,17,18,19) |
| InChIKey | QJSITIQSAWPVFM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 193.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|