About CID 158166559
CID 158166559 (PubChem CID 158166559) has the molecular formula C28H22Na2O6S2
and a molecular weight of 564.59 g/mol.
Molecular Properties
| Compound Name | CID 158166559 |
| PubChem CID | 158166559 |
| Molecular Formula | C28H22Na2O6S2 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1c(-c2ccccc2)cc(C=Cc2ccccc2)c(C=Cc2ccccc2)c1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C28H22O6S2.2Na/c29-35(30,31)27-25(19-17-22-12-6-2-7-13-22)24(18-16-21-10-4-1-5-11-21)20-26(28(27)36(32,33)34)23-14-8-3-9-15-23;;/h1-20H,(H,29,30,31)(H,32,33,34);; |
| InChIKey | FWXKQCGBXHFKDT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158166559 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158166559?
The IUPAC name of CID 158166559 (CID 158166559) is not available.
What is the SMILES notation for CID 158166559?
The canonical SMILES for CID 158166559 is O=S(=O)(O)c1c(-c2ccccc2)cc(C=Cc2ccccc2)c(C=Cc2ccccc2)c1S(=O)(=O)O.[Na].[Na].
What is the InChIKey of CID 158166559?
The InChIKey is FWXKQCGBXHFKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22O6S2.2Na/c29-35(30,31)27-25(19-17-22-12-6-2-7-13-22)24(18-16-21-10-4-1-5-11-21)20-26(28(27)36(32,33)34)23-14-8-3-9-15-23;;/h1-20H,(H,29,30,31)(H,32,33,34);;.
What are the key properties of CID 158166559?
CID 158166559 has a molecular weight of 564.59 g/mol, XLogP of 5.43, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158166559 is sourced from PubChem (CID 158166559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).