C28H22Na2O6S2 — CID 158166559
CID 158166559 (PubChem CID 158166559) has the molecular formula C28H22Na2O6S2 and a molecular weight of 564.59 g/mol.
| Compound Name | CID 158166559 |
|---|---|
| PubChem CID | 158166559 |
| Molecular Formula | C28H22Na2O6S2 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1c(-c2ccccc2)cc(C=Cc2ccccc2)c(C=Cc2ccccc2)c1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C28H22O6S2.2Na/c29-35(30,31)27-25(19-17-22-12-6-2-7-13-22)24(18-16-21-10-4-1-5-11-21)20-26(28(27)36(32,33)34)23-14-8-3-9-15-23;;/h1-20H,(H,29,30,31)(H,32,33,34);; |
| InChIKey | FWXKQCGBXHFKDT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|