About ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide
ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide (PubChem CID 174914865) has the molecular formula C22H21Br
and a molecular weight of 365.31 g/mol. Its IUPAC name is ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide.
Molecular Properties
| Compound Name | ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide |
| PubChem CID | 174914865 |
| Molecular Formula | C22H21Br |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide |
| SMILES | Br.C(=Cc1ccccc1-c1ccccc1)c1ccccc1.C=C |
| InChI | InChI=1S/C20H16.C2H4.BrH/c1-3-9-17(10-4-1)15-16-19-13-7-8-14-20(19)18-11-5-2-6-12-18;1-2;/h1-16H;1-2H2;1H |
| InChIKey | UBPFXYKJDCFQOS-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide?
The IUPAC name of ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide (CID 174914865) is ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide.
What is the SMILES notation for ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide?
The canonical SMILES for ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide is Br.C(=Cc1ccccc1-c1ccccc1)c1ccccc1.C=C.
What is the InChIKey of ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide?
The InChIKey is UBPFXYKJDCFQOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16.C2H4.BrH/c1-3-9-17(10-4-1)15-16-19-13-7-8-14-20(19)18-11-5-2-6-12-18;1-2;/h1-16H;1-2H2;1H.
What are the key properties of ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide?
ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide has a molecular weight of 365.31 g/mol, XLogP of 6.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-phenyl-2-(2-phenylethenyl)benzene;hydrobromide is sourced from PubChem (CID 174914865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).