C28H22O12S4 — CID 174938504
4-(2,4-disulfophenyl)-2,6-bis(2-phenylethenyl)benzene-1,3-disulfonic acid (PubChem CID 174938504) has the molecular formula C28H22O12S4 and a molecular weight of 678.74 g/mol. Its IUPAC name is 4-(2,4-disulfophenyl)-2,6-bis(2-phenylethenyl)benzene-1,3-disulfonic acid.
| Compound Name | 4-(2,4-disulfophenyl)-2,6-bis(2-phenylethenyl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 174938504 |
| Molecular Formula | C28H22O12S4 |
| Molecular Weight | 678.74 g/mol |
| Exact Mass | 678.00 |
| IUPAC Name | 4-(2,4-disulfophenyl)-2,6-bis(2-phenylethenyl)benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(-c2cc(C=Cc3ccccc3)c(S(=O)(=O)O)c(C=Cc3ccccc3)c2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H22O12S4/c29-41(30,31)22-14-16-23(26(18-22)42(32,33)34)25-17-21(13-11-19-7-3-1-4-8-19)27(43(35,36)37)24(28(25)44(38,39)40)15-12-20-9-5-2-6-10-20/h1-18H,(H,29,30,31)(H,32,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | HTASKYWGBKJCNG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.74 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|