C28H23NO6S2 — CID 173044516
4-[2-[4-(6-phenyl-2,3-dihydro-1H-isoindol-1-yl)phenyl]ethenyl]benzene-1,3-disulfonic acid (PubChem CID 173044516) has the molecular formula C28H23NO6S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is 4-[2-[4-(6-phenyl-2,3-dihydro-1H-isoindol-1-yl)phenyl]ethenyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[2-[4-(6-phenyl-2,3-dihydro-1H-isoindol-1-yl)phenyl]ethenyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 173044516 |
| Molecular Formula | C28H23NO6S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 4-[2-[4-(6-phenyl-2,3-dihydro-1H-isoindol-1-yl)phenyl]ethenyl]benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C=Cc2ccc(C3NCc4ccc(-c5ccccc5)cc43)cc2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H23NO6S2/c30-36(31,32)25-15-14-21(27(17-25)37(33,34)35)9-6-19-7-10-22(11-8-19)28-26-16-23(12-13-24(26)18-29-28)20-4-2-1-3-5-20/h1-17,28-29H,18H2,(H,30,31,32)(H,33,34,35) |
| InChIKey | UFAMOSODXRYAKR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|