C28H20Cl2O6S2 — CID 87485430
4-chloro-3-[(E)-2-[4-[4-[(E)-2-(2-chloro-5-sulfophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid (PubChem CID 87485430) has the molecular formula C28H20Cl2O6S2 and a molecular weight of 587.50 g/mol. Its IUPAC name is 4-chloro-3-[(E)-2-[4-[4-[(E)-2-(2-chloro-5-sulfophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 4-chloro-3-[(E)-2-[4-[4-[(E)-2-(2-chloro-5-sulfophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87485430 |
| Molecular Formula | C28H20Cl2O6S2 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | 4-chloro-3-[(E)-2-[4-[4-[(E)-2-(2-chloro-5-sulfophenyl)ethenyl]phenyl]phenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Cl)c(/C=C/c2ccc(-c3ccc(/C=C/c4cc(S(=O)(=O)O)ccc4Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C28H20Cl2O6S2/c29-27-15-13-25(37(31,32)33)17-23(27)11-5-19-1-7-21(8-2-19)22-9-3-20(4-10-22)6-12-24-18-26(38(34,35)36)14-16-28(24)30/h1-18H,(H,31,32,33)(H,34,35,36)/b11-5+,12-6+ |
| InChIKey | GDFMPKQRGSSIBN-YDWXAUTNSA-N |
| XLogP | 7.49 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|