C26H16Cl2O10S3 — CID 89107611
3-[2-chloro-5-[4-chloro-3-(3-sulfobenzoyl)phenyl]sulfonylbenzoyl]benzenesulfonic acid (PubChem CID 89107611) has the molecular formula C26H16Cl2O10S3 and a molecular weight of 655.51 g/mol. Its IUPAC name is 3-[2-chloro-5-[4-chloro-3-(3-sulfobenzoyl)phenyl]sulfonylbenzoyl]benzenesulfonic acid.
| Compound Name | 3-[2-chloro-5-[4-chloro-3-(3-sulfobenzoyl)phenyl]sulfonylbenzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89107611 |
| Molecular Formula | C26H16Cl2O10S3 |
| Molecular Weight | 655.51 g/mol |
| Exact Mass | 653.93 |
| IUPAC Name | 3-[2-chloro-5-[4-chloro-3-(3-sulfobenzoyl)phenyl]sulfonylbenzoyl]benzenesulfonic acid |
| SMILES | O=C(c1cccc(S(=O)(=O)O)c1)c1cc(S(=O)(=O)c2ccc(Cl)c(C(=O)c3cccc(S(=O)(=O)O)c3)c2)ccc1Cl |
| InChI | InChI=1S/C26H16Cl2O10S3/c27-23-9-7-17(13-21(23)25(29)15-3-1-5-19(11-15)40(33,34)35)39(31,32)18-8-10-24(28)22(14-18)26(30)16-4-2-6-20(12-16)41(36,37)38/h1-14H,(H,33,34,35)(H,36,37,38) |
| InChIKey | VTBQACHOPZHURY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|