C24H16N2O8 — CID 95564604
(Z)-2-[3-[(Z)-1-carboxy-2-(2-nitrophenyl)ethenyl]phenyl]-3-(2-nitrophenyl)prop-2-enoic acid (PubChem CID 95564604) has the molecular formula C24H16N2O8 and a molecular weight of 460.40 g/mol. Its IUPAC name is (Z)-2-[3-[(Z)-1-carboxy-2-(2-nitrophenyl)ethenyl]phenyl]-3-(2-nitrophenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[3-[(Z)-1-carboxy-2-(2-nitrophenyl)ethenyl]phenyl]-3-(2-nitrophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 95564604 |
| Molecular Formula | C24H16N2O8 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (Z)-2-[3-[(Z)-1-carboxy-2-(2-nitrophenyl)ethenyl]phenyl]-3-(2-nitrophenyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1[N+](=O)[O-])c1cccc(/C(=C/c2ccccc2[N+](=O)[O-])C(=O)O)c1 |
| InChI | InChI=1S/C24H16N2O8/c27-23(28)19(13-17-6-1-3-10-21(17)25(31)32)15-8-5-9-16(12-15)20(24(29)30)14-18-7-2-4-11-22(18)26(33)34/h1-14H,(H,27,28)(H,29,30)/b19-13-,20-14- |
| InChIKey | GVPWNMIBAOVWOU-AXPXABNXSA-N |
| XLogP | 4.75 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|